C26H32ClN5O2S — CID 23632158
2-[1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]ethyl]-N-cyclohexylquinazolin-4-amine (PubChem CID 23632158) has the molecular formula C26H32ClN5O2S and a molecular weight of 514.10 g/mol. Its IUPAC name is 2-[1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]ethyl]-N-cyclohexylquinazolin-4-amine.
| Compound Name | 2-[1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]ethyl]-N-cyclohexylquinazolin-4-amine |
|---|---|
| PubChem CID | 23632158 |
| Molecular Formula | C26H32ClN5O2S |
| Molecular Weight | 514.10 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 2-[1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]ethyl]-N-cyclohexylquinazolin-4-amine |
| SMILES | CC(c1nc(NC2CCCCC2)c2ccccc2n1)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H32ClN5O2S/c1-19(31-15-17-32(18-16-31)35(33,34)22-13-11-20(27)12-14-22)25-29-24-10-6-5-9-23(24)26(30-25)28-21-7-3-2-4-8-21/h5-6,9-14,19,21H,2-4,7-8,15-18H2,1H3,(H,28,29,30) |
| InChIKey | LSDCYBQQMDDRNQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.10 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |