C25H29BrN4O3S — CID 59993213
2-[1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethyl]-4-cyclopentyloxyquinazoline (PubChem CID 59993213) has the molecular formula C25H29BrN4O3S and a molecular weight of 545.50 g/mol. Its IUPAC name is 2-[1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethyl]-4-cyclopentyloxyquinazoline.
| Compound Name | 2-[1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethyl]-4-cyclopentyloxyquinazoline |
|---|---|
| PubChem CID | 59993213 |
| Molecular Formula | C25H29BrN4O3S |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 2-[1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethyl]-4-cyclopentyloxyquinazoline |
| SMILES | CC(c1nc(OC2CCCC2)c2ccccc2n1)N1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C25H29BrN4O3S/c1-18(29-14-16-30(17-15-29)34(31,32)21-12-10-19(26)11-13-21)24-27-23-9-5-4-8-22(23)25(28-24)33-20-6-2-3-7-20/h4-5,8-13,18,20H,2-3,6-7,14-17H2,1H3 |
| InChIKey | DEMYVRPLKIGCDP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |