C29H38N4O3S — CID 92753661
4-cyclohexyloxy-2-[(1S)-1-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazoline (PubChem CID 92753661) has the molecular formula C29H38N4O3S and a molecular weight of 522.72 g/mol. Its IUPAC name is 4-cyclohexyloxy-2-[(1S)-1-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazoline.
| Compound Name | 4-cyclohexyloxy-2-[(1S)-1-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazoline |
|---|---|
| PubChem CID | 92753661 |
| Molecular Formula | C29H38N4O3S |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 4-cyclohexyloxy-2-[(1S)-1-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazoline |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN([C@@H](C)c3nc(OC4CCCCC4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C29H38N4O3S/c1-3-9-23-14-16-25(17-15-23)37(34,35)33-20-18-32(19-21-33)22(2)28-30-27-13-8-7-12-26(27)29(31-28)36-24-10-5-4-6-11-24/h7-8,12-17,22,24H,3-6,9-11,18-21H2,1-2H3/t22-/m0/s1 |
| InChIKey | JUBLDKLEMBNGIF-QFIPXVFZSA-N |
| XLogP | 5.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |