C27H35N5O2S — CID 97170106
N-cyclohexyl-2-[(1R)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine (PubChem CID 97170106) has the molecular formula C27H35N5O2S and a molecular weight of 493.68 g/mol. Its IUPAC name is N-cyclohexyl-2-[(1R)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine.
| Compound Name | N-cyclohexyl-2-[(1R)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 97170106 |
| Molecular Formula | C27H35N5O2S |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | N-cyclohexyl-2-[(1R)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN([C@H](C)c3nc(NC4CCCCC4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C27H35N5O2S/c1-20-12-14-23(15-13-20)35(33,34)32-18-16-31(17-19-32)21(2)26-29-25-11-7-6-10-24(25)27(30-26)28-22-8-4-3-5-9-22/h6-7,10-15,21-22H,3-5,8-9,16-19H2,1-2H3,(H,28,29,30)/t21-/m1/s1 |
| InChIKey | KSYCIFVDTYWRCJ-OAQYLSRUSA-N |
| XLogP | 4.75 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |