C29H33N5O2S — CID 23632205
2-[1-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]ethyl]-N-(4-methylphenyl)quinazolin-4-amine (PubChem CID 23632205) has the molecular formula C29H33N5O2S and a molecular weight of 515.68 g/mol. Its IUPAC name is 2-[1-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]ethyl]-N-(4-methylphenyl)quinazolin-4-amine.
| Compound Name | 2-[1-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]ethyl]-N-(4-methylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 23632205 |
| Molecular Formula | C29H33N5O2S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 2-[1-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]ethyl]-N-(4-methylphenyl)quinazolin-4-amine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(C(C)c3nc(Nc4ccc(C)cc4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C29H33N5O2S/c1-4-23-11-15-25(16-12-23)37(35,36)34-19-17-33(18-20-34)22(3)28-31-27-8-6-5-7-26(27)29(32-28)30-24-13-9-21(2)10-14-24/h5-16,22H,4,17-20H2,1-3H3,(H,30,31,32) |
| InChIKey | AOXSECODOMKJTD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |