C30H35N5O2S — CID 23632260
2-[1-[4-(4-butylphenyl)sulfonylpiperazin-1-yl]ethyl]-N-phenylquinazolin-4-amine (PubChem CID 23632260) has the molecular formula C30H35N5O2S and a molecular weight of 529.71 g/mol. Its IUPAC name is 2-[1-[4-(4-butylphenyl)sulfonylpiperazin-1-yl]ethyl]-N-phenylquinazolin-4-amine.
| Compound Name | 2-[1-[4-(4-butylphenyl)sulfonylpiperazin-1-yl]ethyl]-N-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 23632260 |
| Molecular Formula | C30H35N5O2S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 2-[1-[4-(4-butylphenyl)sulfonylpiperazin-1-yl]ethyl]-N-phenylquinazolin-4-amine |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CCN(C(C)c3nc(Nc4ccccc4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C30H35N5O2S/c1-3-4-10-24-15-17-26(18-16-24)38(36,37)35-21-19-34(20-22-35)23(2)29-32-28-14-9-8-13-27(28)30(33-29)31-25-11-6-5-7-12-25/h5-9,11-18,23H,3-4,10,19-22H2,1-2H3,(H,31,32,33) |
| InChIKey | RUOHVZZFTPNKLW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |