C31H37N5O4S — CID 98046788
2-[(1S)-1-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-N-(3-methoxyphenyl)quinazolin-4-amine (PubChem CID 98046788) has the molecular formula C31H37N5O4S and a molecular weight of 575.74 g/mol. Its IUPAC name is 2-[(1S)-1-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-N-(3-methoxyphenyl)quinazolin-4-amine.
| Compound Name | 2-[(1S)-1-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-N-(3-methoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 98046788 |
| Molecular Formula | C31H37N5O4S |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 2-[(1S)-1-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-N-(3-methoxyphenyl)quinazolin-4-amine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN([C@@H](C)c3nc(Nc4cccc(OC)c4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C31H37N5O4S/c1-4-5-21-40-25-13-15-27(16-14-25)41(37,38)36-19-17-35(18-20-36)23(2)30-33-29-12-7-6-11-28(29)31(34-30)32-24-9-8-10-26(22-24)39-3/h6-16,22-23H,4-5,17-21H2,1-3H3,(H,32,33,34)/t23-/m0/s1 |
| InChIKey | GMAFRWSXGUUVOL-QHCPKHFHSA-N |
| XLogP | 5.63 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|