C27H29N5O3S — CID 92753550
2-[(1R)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-N-phenylquinazolin-4-amine (PubChem CID 92753550) has the molecular formula C27H29N5O3S and a molecular weight of 503.63 g/mol. Its IUPAC name is 2-[(1R)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-N-phenylquinazolin-4-amine.
| Compound Name | 2-[(1R)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-N-phenylquinazolin-4-amine |
|---|---|
| PubChem CID | 92753550 |
| Molecular Formula | C27H29N5O3S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 2-[(1R)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-N-phenylquinazolin-4-amine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN([C@H](C)c3nc(Nc4ccccc4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C27H29N5O3S/c1-20(31-16-18-32(19-17-31)36(33,34)23-14-12-22(35-2)13-15-23)26-29-25-11-7-6-10-24(25)27(30-26)28-21-8-4-3-5-9-21/h3-15,20H,16-19H2,1-2H3,(H,28,29,30)/t20-/m1/s1 |
| InChIKey | QIZRZFHPLCRCFZ-HXUWFJFHSA-N |
| XLogP | 4.45 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |