C31H37N5O3S — CID 23632164
N-benzyl-2-[1-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine (PubChem CID 23632164) has the molecular formula C31H37N5O3S and a molecular weight of 559.74 g/mol. Its IUPAC name is N-benzyl-2-[1-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine.
| Compound Name | N-benzyl-2-[1-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 23632164 |
| Molecular Formula | C31H37N5O3S |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | N-benzyl-2-[1-[4-(4-butoxyphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN(C(C)c3nc(NCc4ccccc4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C31H37N5O3S/c1-3-4-22-39-26-14-16-27(17-15-26)40(37,38)36-20-18-35(19-21-36)24(2)30-33-29-13-9-8-12-28(29)31(34-30)32-23-25-10-6-5-7-11-25/h5-17,24H,3-4,18-23H2,1-2H3,(H,32,33,34) |
| InChIKey | QHJBTSGWRDKIQT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|