C30H31N7O2S — CID 23632220
N-benzyl-2-[1-[4-(4-pyrazol-1-ylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine (PubChem CID 23632220) has the molecular formula C30H31N7O2S and a molecular weight of 553.69 g/mol. Its IUPAC name is N-benzyl-2-[1-[4-(4-pyrazol-1-ylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine.
| Compound Name | N-benzyl-2-[1-[4-(4-pyrazol-1-ylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 23632220 |
| Molecular Formula | C30H31N7O2S |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | N-benzyl-2-[1-[4-(4-pyrazol-1-ylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
| SMILES | CC(c1nc(NCc2ccccc2)c2ccccc2n1)N1CCN(S(=O)(=O)c2ccc(-n3cccn3)cc2)CC1 |
| InChI | InChI=1S/C30H31N7O2S/c1-23(29-33-28-11-6-5-10-27(28)30(34-29)31-22-24-8-3-2-4-9-24)35-18-20-36(21-19-35)40(38,39)26-14-12-25(13-15-26)37-17-7-16-32-37/h2-17,23H,18-22H2,1H3,(H,31,33,34) |
| InChIKey | DREFSNCAKUGLKN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |