C27H28BrN5O2S — CID 98046695
N-benzyl-2-[(1R)-1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine (PubChem CID 98046695) has the molecular formula C27H28BrN5O2S and a molecular weight of 566.53 g/mol. Its IUPAC name is N-benzyl-2-[(1R)-1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine.
| Compound Name | N-benzyl-2-[(1R)-1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 98046695 |
| Molecular Formula | C27H28BrN5O2S |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | N-benzyl-2-[(1R)-1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
| SMILES | C[C@H](c1nc(NCc2ccccc2)c2ccccc2n1)N1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C27H28BrN5O2S/c1-20(32-15-17-33(18-16-32)36(34,35)23-13-11-22(28)12-14-23)26-30-25-10-6-5-9-24(25)27(31-26)29-19-21-7-3-2-4-8-21/h2-14,20H,15-19H2,1H3,(H,29,30,31)/t20-/m1/s1 |
| InChIKey | OZYLCWDRPWLPIX-HXUWFJFHSA-N |
| XLogP | 5.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |