C31H37N5O2S — CID 23632192
N-benzyl-2-[1-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine (PubChem CID 23632192) has the molecular formula C31H37N5O2S and a molecular weight of 543.74 g/mol. Its IUPAC name is N-benzyl-2-[1-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine.
| Compound Name | N-benzyl-2-[1-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 23632192 |
| Molecular Formula | C31H37N5O2S |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | N-benzyl-2-[1-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-amine |
| SMILES | CC(c1nc(NCc2ccccc2)c2ccccc2n1)N1CCN(S(=O)(=O)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C31H37N5O2S/c1-23(29-33-28-13-9-8-12-27(28)30(34-29)32-22-24-10-6-5-7-11-24)35-18-20-36(21-19-35)39(37,38)26-16-14-25(15-17-26)31(2,3)4/h5-17,23H,18-22H2,1-4H3,(H,32,33,34) |
| InChIKey | RSWDGAFYMLSXIT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |