C28H36N4O3S — CID 92753659
4-cyclohexyloxy-2-[(1S)-1-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazoline (PubChem CID 92753659) has the molecular formula C28H36N4O3S and a molecular weight of 508.69 g/mol. Its IUPAC name is 4-cyclohexyloxy-2-[(1S)-1-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazoline.
| Compound Name | 4-cyclohexyloxy-2-[(1S)-1-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazoline |
|---|---|
| PubChem CID | 92753659 |
| Molecular Formula | C28H36N4O3S |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 4-cyclohexyloxy-2-[(1S)-1-[4-(4-ethylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazoline |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN([C@@H](C)c3nc(OC4CCCCC4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C28H36N4O3S/c1-3-22-13-15-24(16-14-22)36(33,34)32-19-17-31(18-20-32)21(2)27-29-26-12-8-7-11-25(26)28(30-27)35-23-9-5-4-6-10-23/h7-8,11-16,21,23H,3-6,9-10,17-20H2,1-2H3/t21-/m0/s1 |
| InChIKey | GONXSTVKMZOIQR-NRFANRHFSA-N |
| XLogP | 4.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |