C21H24ClN5O2S — CID 91966139
2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-propan-2-ylquinazolin-4-amine (PubChem CID 91966139) has the molecular formula C21H24ClN5O2S and a molecular weight of 445.98 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-propan-2-ylquinazolin-4-amine.
| Compound Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-propan-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 91966139 |
| Molecular Formula | C21H24ClN5O2S |
| Molecular Weight | 445.98 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-N-propan-2-ylquinazolin-4-amine |
| SMILES | CC(C)Nc1nc(N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C21H24ClN5O2S/c1-15(2)23-20-18-5-3-4-6-19(18)24-21(25-20)26-11-13-27(14-12-26)30(28,29)17-9-7-16(22)8-10-17/h3-10,15H,11-14H2,1-2H3,(H,23,24,25) |
| InChIKey | WGHWLUBFQQAULQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.98 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |