C17H23N5O — CID 91966112
1-[4-(propan-2-ylamino)quinazolin-2-yl]piperidine-4-carboxamide (PubChem CID 91966112) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-[4-(propan-2-ylamino)quinazolin-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(propan-2-ylamino)quinazolin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91966112 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-[4-(propan-2-ylamino)quinazolin-2-yl]piperidine-4-carboxamide |
| SMILES | CC(C)Nc1nc(N2CCC(C(N)=O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C17H23N5O/c1-11(2)19-16-13-5-3-4-6-14(13)20-17(21-16)22-9-7-12(8-10-22)15(18)23/h3-6,11-12H,7-10H2,1-2H3,(H2,18,23)(H,19,20,21) |
| InChIKey | WMVSGGNKFPIJRT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |