C26H31N5O — CID 7335362
cyclopentyl-[4-[4-[[(1S)-1-phenylethyl]amino]quinazolin-2-yl]piperazin-1-yl]methanone (PubChem CID 7335362) has the molecular formula C26H31N5O and a molecular weight of 429.57 g/mol. Its IUPAC name is cyclopentyl-[4-[4-[[(1S)-1-phenylethyl]amino]quinazolin-2-yl]piperazin-1-yl]methanone.
| Compound Name | cyclopentyl-[4-[4-[[(1S)-1-phenylethyl]amino]quinazolin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 7335362 |
| Molecular Formula | C26H31N5O |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | cyclopentyl-[4-[4-[[(1S)-1-phenylethyl]amino]quinazolin-2-yl]piperazin-1-yl]methanone |
| SMILES | C[C@H](Nc1nc(N2CCN(C(=O)C3CCCC3)CC2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H31N5O/c1-19(20-9-3-2-4-10-20)27-24-22-13-7-8-14-23(22)28-26(29-24)31-17-15-30(16-18-31)25(32)21-11-5-6-12-21/h2-4,7-10,13-14,19,21H,5-6,11-12,15-18H2,1H3,(H,27,28,29)/t19-/m0/s1 |
| InChIKey | JYEIISOLXADLNZ-IBGZPJMESA-N |
| XLogP | 4.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |