C21H24Cl2N4 — CID 68723199
N-[(1R)-1-(4-chlorophenyl)ethyl]-2-piperidin-1-ylquinazolin-4-amine;hydrochloride (PubChem CID 68723199) has the molecular formula C21H24Cl2N4 and a molecular weight of 403.36 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-2-piperidin-1-ylquinazolin-4-amine;hydrochloride.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-piperidin-1-ylquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 68723199 |
| Molecular Formula | C21H24Cl2N4 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-piperidin-1-ylquinazolin-4-amine;hydrochloride |
| SMILES | C[C@@H](Nc1nc(N2CCCCC2)nc2ccccc12)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C21H23ClN4.ClH/c1-15(16-9-11-17(22)12-10-16)23-20-18-7-3-4-8-19(18)24-21(25-20)26-13-5-2-6-14-26;/h3-4,7-12,15H,2,5-6,13-14H2,1H3,(H,23,24,25);1H/t15-;/m1./s1 |
| InChIKey | SNDCHCSDSHTGLC-XFULWGLBSA-N |
| XLogP | 5.87 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |