C23H28N4O — CID 164569939
ethane;1-phenyl-2-[(2-piperidin-1-ylquinazolin-4-yl)amino]ethanone (PubChem CID 164569939) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is ethane;1-phenyl-2-[(2-piperidin-1-ylquinazolin-4-yl)amino]ethanone.
| Compound Name | ethane;1-phenyl-2-[(2-piperidin-1-ylquinazolin-4-yl)amino]ethanone |
|---|---|
| PubChem CID | 164569939 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | ethane;1-phenyl-2-[(2-piperidin-1-ylquinazolin-4-yl)amino]ethanone |
| SMILES | CC.O=C(CNc1nc(N2CCCCC2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H22N4O.C2H6/c26-19(16-9-3-1-4-10-16)15-22-20-17-11-5-6-12-18(17)23-21(24-20)25-13-7-2-8-14-25;1-2/h1,3-6,9-12H,2,7-8,13-15H2,(H,22,23,24);1-2H3 |
| InChIKey | HAKMRQGCRXNCDG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |