C29H38N6O2 — CID 164569952
N-[(1-methylpiperidin-4-yl)methyl]-3-[2-[(2-piperidin-1-ylquinazolin-4-yl)amino]ethoxy]benzamide (PubChem CID 164569952) has the molecular formula C29H38N6O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is N-[(1-methylpiperidin-4-yl)methyl]-3-[2-[(2-piperidin-1-ylquinazolin-4-yl)amino]ethoxy]benzamide.
| Compound Name | N-[(1-methylpiperidin-4-yl)methyl]-3-[2-[(2-piperidin-1-ylquinazolin-4-yl)amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 164569952 |
| Molecular Formula | C29H38N6O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | N-[(1-methylpiperidin-4-yl)methyl]-3-[2-[(2-piperidin-1-ylquinazolin-4-yl)amino]ethoxy]benzamide |
| SMILES | CN1CCC(CNC(=O)c2cccc(OCCNc3nc(N4CCCCC4)nc4ccccc34)c2)CC1 |
| InChI | InChI=1S/C29H38N6O2/c1-34-17-12-22(13-18-34)21-31-28(36)23-8-7-9-24(20-23)37-19-14-30-27-25-10-3-4-11-26(25)32-29(33-27)35-15-5-2-6-16-35/h3-4,7-11,20,22H,2,5-6,12-19,21H2,1H3,(H,31,36)(H,30,32,33) |
| InChIKey | KQKUGGFQCCEYEM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|