C20H19Cl2N3O2 — CID 121109471
N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-3,5-dichlorobenzamide (PubChem CID 121109471) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-3,5-dichlorobenzamide.
| Compound Name | N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 121109471 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-3,5-dichlorobenzamide |
| SMILES | O=C(NCC1CCN(c2nc3ccccc3o2)CC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c21-15-9-14(10-16(22)11-15)19(26)23-12-13-5-7-25(8-6-13)20-24-17-3-1-2-4-18(17)27-20/h1-4,9-11,13H,5-8,12H2,(H,23,26) |
| InChIKey | FUOMACAYVMSMFR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |