C19H26N4O3 — CID 121107967
N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-N'-(2-methylpropyl)oxamide (PubChem CID 121107967) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-N'-(2-methylpropyl)oxamide.
| Compound Name | N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-N'-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 121107967 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-N'-(2-methylpropyl)oxamide |
| SMILES | CC(C)CNC(=O)C(=O)NCC1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C19H26N4O3/c1-13(2)11-20-17(24)18(25)21-12-14-7-9-23(10-8-14)19-22-15-5-3-4-6-16(15)26-19/h3-6,13-14H,7-12H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | VVSBZGJKJAURAQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|