C23H26N4O3 — CID 121107989
N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-N'-(2,3-dimethylphenyl)oxamide (PubChem CID 121107989) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-N'-(2,3-dimethylphenyl)oxamide.
| Compound Name | N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-N'-(2,3-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 121107989 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-N'-(2,3-dimethylphenyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NCC2CCN(c3nc4ccccc4o3)CC2)c1C |
| InChI | InChI=1S/C23H26N4O3/c1-15-6-5-8-18(16(15)2)25-22(29)21(28)24-14-17-10-12-27(13-11-17)23-26-19-7-3-4-9-20(19)30-23/h3-9,17H,10-14H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | VKHGGSFPWLGJEM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|