C22H28N4O2 — CID 16887143
N'-(2,3-dimethylphenyl)-N-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]oxamide (PubChem CID 16887143) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N'-(2,3-dimethylphenyl)-N-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(2,3-dimethylphenyl)-N-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 16887143 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N'-(2,3-dimethylphenyl)-N-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NCC2CCN(Cc3ccncc3)CC2)c1C |
| InChI | InChI=1S/C22H28N4O2/c1-16-4-3-5-20(17(16)2)25-22(28)21(27)24-14-18-8-12-26(13-9-18)15-19-6-10-23-11-7-19/h3-7,10-11,18H,8-9,12-15H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | YMNSIFHAQPSJQV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|