C22H27N3O2S — CID 16886848
N-[(1-benzylpiperidin-4-yl)methyl]-N'-(3-methylsulfanylphenyl)oxamide (PubChem CID 16886848) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-yl)methyl]-N'-(3-methylsulfanylphenyl)oxamide.
| Compound Name | N-[(1-benzylpiperidin-4-yl)methyl]-N'-(3-methylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 16886848 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[(1-benzylpiperidin-4-yl)methyl]-N'-(3-methylsulfanylphenyl)oxamide |
| SMILES | CSc1cccc(NC(=O)C(=O)NCC2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-28-20-9-5-8-19(14-20)24-22(27)21(26)23-15-17-10-12-25(13-11-17)16-18-6-3-2-4-7-18/h2-9,14,17H,10-13,15-16H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | KZXKDIGSZAVXCP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|