C17H24N4O2 — CID 121109518
1-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-3-propan-2-ylurea (PubChem CID 121109518) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-3-propan-2-ylurea.
| Compound Name | 1-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 121109518 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[[1-(1,3-benzoxazol-2-yl)piperidin-4-yl]methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCC1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C17H24N4O2/c1-12(2)19-16(22)18-11-13-7-9-21(10-8-13)17-20-14-5-3-4-6-15(14)23-17/h3-6,12-13H,7-11H2,1-2H3,(H2,18,19,22) |
| InChIKey | JBDYJSGQKMOUGP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |