C27H41N7O3 — CID 23758346
N-[2-[2-[2-[[4-(cyclohexylamino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23758346) has the molecular formula C27H41N7O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-(cyclohexylamino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-(cyclohexylamino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23758346 |
| Molecular Formula | C27H41N7O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | N-[2-[2-[2-[[4-(cyclohexylamino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | O=C(NCCOCCOCCNc1nc(NC2CCCCC2)nc(N2CCCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C27H41N7O3/c35-24(22-10-4-1-5-11-22)28-14-18-36-20-21-37-19-15-29-25-31-26(30-23-12-6-2-7-13-23)33-27(32-25)34-16-8-3-9-17-34/h1,4-5,10-11,23H,2-3,6-9,12-21H2,(H,28,35)(H2,29,30,31,32,33) |
| InChIKey | NSSPXPVZUCSKDT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|