C26H39N7O3 — CID 23787516
N-[2-[2-[2-[[4,6-bis(cyclopentylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23787516) has the molecular formula C26H39N7O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[2-[2-[2-[[4,6-bis(cyclopentylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4,6-bis(cyclopentylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23787516 |
| Molecular Formula | C26H39N7O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | N-[2-[2-[2-[[4,6-bis(cyclopentylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | O=C(NCCOCCOCCNc1nc(NC2CCCC2)nc(NC2CCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C26H39N7O3/c34-23(20-8-2-1-3-9-20)27-14-16-35-18-19-36-17-15-28-24-31-25(29-21-10-4-5-11-21)33-26(32-24)30-22-12-6-7-13-22/h1-3,8-9,21-22H,4-7,10-19H2,(H,27,34)(H3,28,29,30,31,32,33) |
| InChIKey | ILSQCQNAWAMHPB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|