C33H43N7O3 — CID 23984632
N-[2-[2-[2-[[4-(2-adamantylamino)-6-(benzylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23984632) has the molecular formula C33H43N7O3 and a molecular weight of 585.75 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-(2-adamantylamino)-6-(benzylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-(2-adamantylamino)-6-(benzylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23984632 |
| Molecular Formula | C33H43N7O3 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.34 |
| IUPAC Name | N-[2-[2-[2-[[4-(2-adamantylamino)-6-(benzylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | O=C(NCCOCCOCCNc1nc(NCc2ccccc2)nc(NC2C3CC4CC(C3)CC2C4)n1)c1ccccc1 |
| InChI | InChI=1S/C33H43N7O3/c41-30(26-9-5-2-6-10-26)34-11-13-42-15-16-43-14-12-35-31-38-32(36-22-23-7-3-1-4-8-23)40-33(39-31)37-29-27-18-24-17-25(20-27)21-28(29)19-24/h1-10,24-25,27-29H,11-22H2,(H,34,41)(H3,35,36,37,38,39,40) |
| InChIKey | UOEMAIFHAVKDAI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|