C32H39N7O5 — CID 23758354
N-[2-[2-[2-[[4-[2-(3,4-dihydroxyphenyl)ethylamino]-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23758354) has the molecular formula C32H39N7O5 and a molecular weight of 601.71 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-[2-(3,4-dihydroxyphenyl)ethylamino]-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-[2-(3,4-dihydroxyphenyl)ethylamino]-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23758354 |
| Molecular Formula | C32H39N7O5 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | N-[2-[2-[2-[[4-[2-(3,4-dihydroxyphenyl)ethylamino]-6-(2-phenylethylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | O=C(NCCOCCOCCNc1nc(NCCc2ccccc2)nc(NCCc2ccc(O)c(O)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C32H39N7O5/c40-27-12-11-25(23-28(27)41)14-16-35-31-37-30(34-15-13-24-7-3-1-4-8-24)38-32(39-31)36-18-20-44-22-21-43-19-17-33-29(42)26-9-5-2-6-10-26/h1-12,23,40-41H,13-22H2,(H,33,42)(H3,34,35,36,37,38,39) |
| InChIKey | WGQLNCITFPNSAA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|