C30H39N9O6 — CID 23787494
N-[2-[2-[2-[[4-morpholin-4-yl-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 23787494) has the molecular formula C30H39N9O6 and a molecular weight of 621.70 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-morpholin-4-yl-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-morpholin-4-yl-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 23787494 |
| Molecular Formula | C30H39N9O6 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | N-[2-[2-[2-[[4-morpholin-4-yl-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | O=C(NCCOCCOCCNc1nc(N2CCOCC2)nc(N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n1)c1ccccc1 |
| InChI | InChI=1S/C30H39N9O6/c40-27(24-4-2-1-3-5-24)31-10-18-43-22-23-44-19-11-32-28-33-29(35-30(34-28)38-16-20-45-21-17-38)37-14-12-36(13-15-37)25-6-8-26(9-7-25)39(41)42/h1-9H,10-23H2,(H,31,40)(H,32,33,34,35) |
| InChIKey | SJHNLFFLCOTAMY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 160.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|