C26H34FN9O4 — CID 23901041
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(4-fluorophenyl)methyl]-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 23901041) has the molecular formula C26H34FN9O4 and a molecular weight of 555.62 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(4-fluorophenyl)methyl]-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(4-fluorophenyl)methyl]-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23901041 |
| Molecular Formula | C26H34FN9O4 |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-N-[(4-fluorophenyl)methyl]-6-[4-(4-nitrophenyl)piperazin-1-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | NCCOCCOCCNc1nc(NCc2ccc(F)cc2)nc(N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)n1 |
| InChI | InChI=1S/C26H34FN9O4/c27-21-3-1-20(2-4-21)19-30-25-31-24(29-10-16-40-18-17-39-15-9-28)32-26(33-25)35-13-11-34(12-14-35)22-5-7-23(8-6-22)36(37)38/h1-8H,9-19,28H2,(H2,29,30,31,32,33) |
| InChIKey | YPADHLFWPSJKKN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 156.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|