C24H39FN6O8 — CID 158684702
2-[2-(2-aminoethoxy)ethoxy]ethanamine;N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-nitroaniline;1-fluoro-4-nitrobenzene (PubChem CID 158684702) has the molecular formula C24H39FN6O8 and a molecular weight of 558.61 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)ethoxy]ethanamine;N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-nitroaniline;1-fluoro-4-nitrobenzene.
| Compound Name | 2-[2-(2-aminoethoxy)ethoxy]ethanamine;N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-nitroaniline;1-fluoro-4-nitrobenzene |
|---|---|
| PubChem CID | 158684702 |
| Molecular Formula | C24H39FN6O8 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 2-[2-(2-aminoethoxy)ethoxy]ethanamine;N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-nitroaniline;1-fluoro-4-nitrobenzene |
| SMILES | NCCOCCOCCN.NCCOCCOCCNc1ccc([N+](=O)[O-])cc1.O=[N+]([O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C12H19N3O4.C6H4FNO2.C6H16N2O2/c13-5-7-18-9-10-19-8-6-14-11-1-3-12(4-2-11)15(16)17;7-5-1-3-6(4-2-5)8(9)10;7-1-3-9-5-6-10-4-2-8/h1-4,14H,5-10,13H2;1-4H;1-8H2 |
| InChIKey | IFOWMLIDISOZEW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 213.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|