C12H18N4O6 — CID 135258913
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,6-dinitroaniline (PubChem CID 135258913) has the molecular formula C12H18N4O6 and a molecular weight of 314.30 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,6-dinitroaniline.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,6-dinitroaniline |
|---|---|
| PubChem CID | 135258913 |
| Molecular Formula | C12H18N4O6 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,6-dinitroaniline |
| SMILES | NCCOCCOCCNc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O6/c13-4-6-21-8-9-22-7-5-14-12-10(15(17)18)2-1-3-11(12)16(19)20/h1-3,14H,4-9,13H2 |
| InChIKey | FVHFLVXWJFMKQL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 142.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|