C29H53N5O10 — CID 142616030
tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;tert-butyl N-[2-[2-[2-(3-methyl-2-nitroanilino)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 142616030) has the molecular formula C29H53N5O10 and a molecular weight of 631.77 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;tert-butyl N-[2-[2-[2-(3-methyl-2-nitroanilino)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;tert-butyl N-[2-[2-[2-(3-methyl-2-nitroanilino)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 142616030 |
| Molecular Formula | C29H53N5O10 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.38 |
| IUPAC Name | tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate;tert-butyl N-[2-[2-[2-(3-methyl-2-nitroanilino)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCN.Cc1cccc(NCCOCCOCCNC(=O)OC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H29N3O6.C11H24N2O4/c1-14-6-5-7-15(16(14)21(23)24)19-8-10-25-12-13-26-11-9-20-17(22)27-18(2,3)4;1-11(2,3)17-10(14)13-5-7-16-9-8-15-6-4-12/h5-7,19H,8-13H2,1-4H3,(H,20,22);4-9,12H2,1-3H3,(H,13,14) |
| InChIKey | WJMCVFKMOHWMPB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 194.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|