C21H31N3O7 — CID 163291733
tert-butyl N-[2-[2-[2-[2-[(1,3-dioxoisoindol-4-yl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 163291733) has the molecular formula C21H31N3O7 and a molecular weight of 437.49 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[(1,3-dioxoisoindol-4-yl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[(1,3-dioxoisoindol-4-yl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 163291733 |
| Molecular Formula | C21H31N3O7 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[(1,3-dioxoisoindol-4-yl)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCNc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C21H31N3O7/c1-21(2,3)31-20(27)23-8-10-29-12-14-30-13-11-28-9-7-22-16-6-4-5-15-17(16)19(26)24-18(15)25/h4-6,22H,7-14H2,1-3H3,(H,23,27)(H,24,25,26) |
| InChIKey | FGJYJOBNCFDKHM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|