C9H6N2O4 — CID 69050787
(1,3-dioxoisoindol-4-yl)carbamic acid (PubChem CID 69050787) has the molecular formula C9H6N2O4 and a molecular weight of 206.16 g/mol. Its IUPAC name is (1,3-dioxoisoindol-4-yl)carbamic acid.
| Compound Name | (1,3-dioxoisoindol-4-yl)carbamic acid |
|---|---|
| PubChem CID | 69050787 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | (1,3-dioxoisoindol-4-yl)carbamic acid |
| SMILES | O=C(O)Nc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C9H6N2O4/c12-7-4-2-1-3-5(10-9(14)15)6(4)8(13)11-7/h1-3,10H,(H,14,15)(H,11,12,13) |
| InChIKey | QXAJQPZJURZNEZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|