C13H9N3O4 — CID 143568233
5-amino-N-(1,3-dioxoisoindol-4-yl)furan-2-carboxamide (PubChem CID 143568233) has the molecular formula C13H9N3O4 and a molecular weight of 271.23 g/mol. Its IUPAC name is 5-amino-N-(1,3-dioxoisoindol-4-yl)furan-2-carboxamide.
| Compound Name | 5-amino-N-(1,3-dioxoisoindol-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 143568233 |
| Molecular Formula | C13H9N3O4 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 5-amino-N-(1,3-dioxoisoindol-4-yl)furan-2-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2cccc3c2C(=O)NC3=O)o1 |
| InChI | InChI=1S/C13H9N3O4/c14-9-5-4-8(20-9)12(18)15-7-3-1-2-6-10(7)13(19)16-11(6)17/h1-5H,14H2,(H,15,18)(H,16,17,19) |
| InChIKey | XWQDVGPBQZITAC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|