C17H14N2O3 — CID 2086901
N-(1,3-dioxoisoindol-4-yl)-2,4-dimethylbenzamide (PubChem CID 2086901) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-4-yl)-2,4-dimethylbenzamide.
| Compound Name | N-(1,3-dioxoisoindol-4-yl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 2086901 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(1,3-dioxoisoindol-4-yl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc3c2C(=O)NC3=O)c(C)c1 |
| InChI | InChI=1S/C17H14N2O3/c1-9-6-7-11(10(2)8-9)15(20)18-13-5-3-4-12-14(13)17(22)19-16(12)21/h3-8H,1-2H3,(H,18,20)(H,19,21,22) |
| InChIKey | XWKYETHCSYDODB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|