C15H8Cl2N2O3 — CID 9324882
3,4-dichloro-N-(1,3-dioxoisoindol-4-yl)benzamide (PubChem CID 9324882) has the molecular formula C15H8Cl2N2O3 and a molecular weight of 335.15 g/mol. Its IUPAC name is 3,4-dichloro-N-(1,3-dioxoisoindol-4-yl)benzamide.
| Compound Name | 3,4-dichloro-N-(1,3-dioxoisoindol-4-yl)benzamide |
|---|---|
| PubChem CID | 9324882 |
| Molecular Formula | C15H8Cl2N2O3 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 3,4-dichloro-N-(1,3-dioxoisoindol-4-yl)benzamide |
| SMILES | O=C(Nc1cccc2c1C(=O)NC2=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H8Cl2N2O3/c16-9-5-4-7(6-10(9)17)13(20)18-11-3-1-2-8-12(11)15(22)19-14(8)21/h1-6H,(H,18,20)(H,19,21,22) |
| InChIKey | MOQFMCLGYJFIOB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|