C14H8ClN3O3 — CID 2428874
2-chloro-N-(1,3-dioxoisoindol-4-yl)pyridine-3-carboxamide (PubChem CID 2428874) has the molecular formula C14H8ClN3O3 and a molecular weight of 301.69 g/mol. Its IUPAC name is 2-chloro-N-(1,3-dioxoisoindol-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(1,3-dioxoisoindol-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2428874 |
| Molecular Formula | C14H8ClN3O3 |
| Molecular Weight | 301.69 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-chloro-N-(1,3-dioxoisoindol-4-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc2c1C(=O)NC2=O)c1cccnc1Cl |
| InChI | InChI=1S/C14H8ClN3O3/c15-11-8(4-2-6-16-11)13(20)17-9-5-1-3-7-10(9)14(21)18-12(7)19/h1-6H,(H,17,20)(H,18,19,21) |
| InChIKey | VSKXESHQUZKVRT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.69 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|