C17H15N3O5S — CID 2379537
3-(dimethylsulfamoyl)-N-(1,3-dioxoisoindol-4-yl)benzamide (PubChem CID 2379537) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-(1,3-dioxoisoindol-4-yl)benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-(1,3-dioxoisoindol-4-yl)benzamide |
|---|---|
| PubChem CID | 2379537 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-(1,3-dioxoisoindol-4-yl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)Nc2cccc3c2C(=O)NC3=O)c1 |
| InChI | InChI=1S/C17H15N3O5S/c1-20(2)26(24,25)11-6-3-5-10(9-11)15(21)18-13-8-4-7-12-14(13)17(23)19-16(12)22/h3-9H,1-2H3,(H,18,21)(H,19,22,23) |
| InChIKey | YAIDZHINNREXAB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|