C23H19N3O2 — CID 100766377
2,4-dimethyl-N-[2-(3-oxo-4H-quinoxalin-2-yl)phenyl]benzamide (PubChem CID 100766377) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2,4-dimethyl-N-[2-(3-oxo-4H-quinoxalin-2-yl)phenyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[2-(3-oxo-4H-quinoxalin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 100766377 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2,4-dimethyl-N-[2-(3-oxo-4H-quinoxalin-2-yl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2-c2nc3ccccc3[nH]c2=O)c(C)c1 |
| InChI | InChI=1S/C23H19N3O2/c1-14-11-12-16(15(2)13-14)22(27)25-18-8-4-3-7-17(18)21-23(28)26-20-10-6-5-9-19(20)24-21/h3-13H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | OOSASCSESBPANY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |