C16H15N3O3S — CID 6463853
N-[4-methyl-2-(3-oxo-4H-quinoxalin-2-yl)phenyl]methanesulfonamide (PubChem CID 6463853) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[4-methyl-2-(3-oxo-4H-quinoxalin-2-yl)phenyl]methanesulfonamide.
| Compound Name | N-[4-methyl-2-(3-oxo-4H-quinoxalin-2-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 6463853 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[4-methyl-2-(3-oxo-4H-quinoxalin-2-yl)phenyl]methanesulfonamide |
| SMILES | Cc1ccc(NS(C)(=O)=O)c(-c2nc3ccccc3[nH]c2=O)c1 |
| InChI | InChI=1S/C16H15N3O3S/c1-10-7-8-12(19-23(2,21)22)11(9-10)15-16(20)18-14-6-4-3-5-13(14)17-15/h3-9,19H,1-2H3,(H,18,20) |
| InChIKey | QVSBCXWWXXRQCJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |