C15H13ClINO — CID 113257834
N-(4-chloro-2-iodophenyl)-2,4-dimethylbenzamide (PubChem CID 113257834) has the molecular formula C15H13ClINO and a molecular weight of 385.63 g/mol. Its IUPAC name is N-(4-chloro-2-iodophenyl)-2,4-dimethylbenzamide.
| Compound Name | N-(4-chloro-2-iodophenyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 113257834 |
| Molecular Formula | C15H13ClINO |
| Molecular Weight | 385.63 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | N-(4-chloro-2-iodophenyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Cl)cc2I)c(C)c1 |
| InChI | InChI=1S/C15H13ClINO/c1-9-3-5-12(10(2)7-9)15(19)18-14-6-4-11(16)8-13(14)17/h3-8H,1-2H3,(H,18,19) |
| InChIKey | WQKXJXIXYVALIK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|