About N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide
N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide (PubChem CID 1287536) has the molecular formula C15H13ClINO
and a molecular weight of 385.63 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide |
| PubChem CID | 1287536 |
| Molecular Formula | C15H13ClINO |
| Molecular Weight | 385.63 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(I)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C15H13ClINO/c1-9-3-5-12(10(2)7-9)15(19)18-14-6-4-11(17)8-13(14)16/h3-8H,1-2H3,(H,18,19) |
| InChIKey | NUUXHKMGGIVUEF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide?
The IUPAC name of N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide (CID 1287536) is N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide.
What is the SMILES notation for N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide?
The canonical SMILES for N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide is Cc1ccc(C(=O)Nc2ccc(I)cc2Cl)c(C)c1.
What is the InChIKey of N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide?
The InChIKey is NUUXHKMGGIVUEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClINO/c1-9-3-5-12(10(2)7-9)15(19)18-14-6-4-11(17)8-13(14)16/h3-8H,1-2H3,(H,18,19).
What are the key properties of N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide?
N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide has a molecular weight of 385.63 g/mol, XLogP of 4.81, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4-iodophenyl)-2,4-dimethylbenzamide is sourced from PubChem (CID 1287536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).