C14H9ClN2O3S — CID 41340452
2-(5-chlorothiophen-2-yl)-N-(1,3-dioxoisoindol-4-yl)acetamide (PubChem CID 41340452) has the molecular formula C14H9ClN2O3S and a molecular weight of 320.76 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-(1,3-dioxoisoindol-4-yl)acetamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-(1,3-dioxoisoindol-4-yl)acetamide |
|---|---|
| PubChem CID | 41340452 |
| Molecular Formula | C14H9ClN2O3S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-(1,3-dioxoisoindol-4-yl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)s1)Nc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C14H9ClN2O3S/c15-10-5-4-7(21-10)6-11(18)16-9-3-1-2-8-12(9)14(20)17-13(8)19/h1-5H,6H2,(H,16,18)(H,17,19,20) |
| InChIKey | AVJDQTCXOCLQOG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|