C12H8Cl3NOS — CID 41340579
2-(5-chlorothiophen-2-yl)-N-(2,5-dichlorophenyl)acetamide (PubChem CID 41340579) has the molecular formula C12H8Cl3NOS and a molecular weight of 320.63 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 41340579 |
| Molecular Formula | C12H8Cl3NOS |
| Molecular Weight | 320.63 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-(2,5-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)s1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H8Cl3NOS/c13-7-1-3-9(14)10(5-7)16-12(17)6-8-2-4-11(15)18-8/h1-5H,6H2,(H,16,17) |
| InChIKey | ZVOWLRCJEKXMJG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |