C20H14N2O3 — CID 727482
N-(1,3-dioxoisoindol-4-yl)-2-naphthalen-1-ylacetamide (PubChem CID 727482) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-4-yl)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(1,3-dioxoisoindol-4-yl)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 727482 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(1,3-dioxoisoindol-4-yl)-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)Nc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C20H14N2O3/c23-17(11-13-7-3-6-12-5-1-2-8-14(12)13)21-16-10-4-9-15-18(16)20(25)22-19(15)24/h1-10H,11H2,(H,21,23)(H,22,24,25) |
| InChIKey | WTMDERKPVCVBGV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|