C15H13ClN2O3 — CID 142209593
(2E,4E)-5-chloro-N-(1,3-dioxoisoindol-4-yl)-2-methylhexa-2,4-dienamide (PubChem CID 142209593) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is (2E,4E)-5-chloro-N-(1,3-dioxoisoindol-4-yl)-2-methylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-5-chloro-N-(1,3-dioxoisoindol-4-yl)-2-methylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 142209593 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (2E,4E)-5-chloro-N-(1,3-dioxoisoindol-4-yl)-2-methylhexa-2,4-dienamide |
| SMILES | C/C(Cl)=C\C=C(/C)C(=O)Nc1cccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C15H13ClN2O3/c1-8(6-7-9(2)16)13(19)17-11-5-3-4-10-12(11)15(21)18-14(10)20/h3-7H,1-2H3,(H,17,19)(H,18,20,21)/b8-6+,9-7+ |
| InChIKey | SLIOAMALKDGAQM-CDJQDVQCSA-N |
| XLogP | 2.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|