C13H15ClN2O — CID 130413317
(2E,4E)-N-(3-aminophenyl)-5-chloro-2-methylhexa-2,4-dienamide (PubChem CID 130413317) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is (2E,4E)-N-(3-aminophenyl)-5-chloro-2-methylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(3-aminophenyl)-5-chloro-2-methylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 130413317 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (2E,4E)-N-(3-aminophenyl)-5-chloro-2-methylhexa-2,4-dienamide |
| SMILES | C/C(Cl)=C\C=C(/C)C(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C13H15ClN2O/c1-9(6-7-10(2)14)13(17)16-12-5-3-4-11(15)8-12/h3-8H,15H2,1-2H3,(H,16,17)/b9-6+,10-7+ |
| InChIKey | BGAFCXWMWXWNAU-KZZDLZNXSA-N |
| XLogP | 3.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|